C16H14BrN3O3 — CID 168549867
methyl 1-(2-acetyl-4-bromo-5-methylphenyl)-3-amino-4-cyanopyrrole-2-carboxylate (PubChem CID 168549867) has the molecular formula C16H14BrN3O3 and a molecular weight of 376.21 g/mol. Its IUPAC name is methyl 1-(2-acetyl-4-bromo-5-methylphenyl)-3-amino-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 1-(2-acetyl-4-bromo-5-methylphenyl)-3-amino-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549867 |
| Molecular Formula | C16H14BrN3O3 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | methyl 1-(2-acetyl-4-bromo-5-methylphenyl)-3-amino-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(C)c(Br)cc1C(C)=O |
| InChI | InChI=1S/C16H14BrN3O3/c1-8-4-13(11(9(2)21)5-12(8)17)20-7-10(6-18)14(19)15(20)16(22)23-3/h4-5,7H,19H2,1-3H3 |
| InChIKey | VZEZJNFZSZCURU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |