C20H14F3N3O2 — CID 168547100
methyl 3-amino-4-cyano-1-[4-[3-(trifluoromethyl)phenyl]phenyl]pyrrole-2-carboxylate (PubChem CID 168547100) has the molecular formula C20H14F3N3O2 and a molecular weight of 385.35 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[4-[3-(trifluoromethyl)phenyl]phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[4-[3-(trifluoromethyl)phenyl]phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547100 |
| Molecular Formula | C20H14F3N3O2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[4-[3-(trifluoromethyl)phenyl]phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H14F3N3O2/c1-28-19(27)18-17(25)14(10-24)11-26(18)16-7-5-12(6-8-16)13-3-2-4-15(9-13)20(21,22)23/h2-9,11H,25H2,1H3 |
| InChIKey | VGYGXYHXEAPOBE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |