C23H20F3N3O5 — CID 168550215
methyl 3-amino-4-cyano-1-[3-(dimethoxymethyl)-4-[3-(trifluoromethyl)phenoxy]phenyl]pyrrole-2-carboxylate (PubChem CID 168550215) has the molecular formula C23H20F3N3O5 and a molecular weight of 475.42 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[3-(dimethoxymethyl)-4-[3-(trifluoromethyl)phenoxy]phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[3-(dimethoxymethyl)-4-[3-(trifluoromethyl)phenoxy]phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168550215 |
| Molecular Formula | C23H20F3N3O5 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[3-(dimethoxymethyl)-4-[3-(trifluoromethyl)phenoxy]phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(Oc2cccc(C(F)(F)F)c2)c(C(OC)OC)c1 |
| InChI | InChI=1S/C23H20F3N3O5/c1-31-21(30)20-19(28)13(11-27)12-29(20)15-7-8-18(17(10-15)22(32-2)33-3)34-16-6-4-5-14(9-16)23(24,25)26/h4-10,12,22H,28H2,1-3H3 |
| InChIKey | SWTUCIMWOKEFJK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|