C19H14ClN3O3 — CID 168547279
methyl 3-amino-1-[2-(3-chlorophenoxy)phenyl]-4-cyanopyrrole-2-carboxylate (PubChem CID 168547279) has the molecular formula C19H14ClN3O3 and a molecular weight of 367.79 g/mol. Its IUPAC name is methyl 3-amino-1-[2-(3-chlorophenoxy)phenyl]-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-[2-(3-chlorophenoxy)phenyl]-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547279 |
| Molecular Formula | C19H14ClN3O3 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | methyl 3-amino-1-[2-(3-chlorophenoxy)phenyl]-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccccc1Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H14ClN3O3/c1-25-19(24)18-17(22)12(10-21)11-23(18)15-7-2-3-8-16(15)26-14-6-4-5-13(20)9-14/h2-9,11H,22H2,1H3 |
| InChIKey | OHDCVCZZVUJBFQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |