C14H12IN3O3 — CID 168545828
methyl 3-amino-4-cyano-1-(3-iodo-4-methoxyphenyl)pyrrole-2-carboxylate (PubChem CID 168545828) has the molecular formula C14H12IN3O3 and a molecular weight of 397.17 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(3-iodo-4-methoxyphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(3-iodo-4-methoxyphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168545828 |
| Molecular Formula | C14H12IN3O3 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(3-iodo-4-methoxyphenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(OC)c(I)c1 |
| InChI | InChI=1S/C14H12IN3O3/c1-20-11-4-3-9(5-10(11)15)18-7-8(6-16)12(17)13(18)14(19)21-2/h3-5,7H,17H2,1-2H3 |
| InChIKey | LDSFWRBZFNQPMT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|