C17H12FN3O2 — CID 168547295
methyl 3-amino-4-cyano-1-(6-fluoronaphthalen-2-yl)pyrrole-2-carboxylate (PubChem CID 168547295) has the molecular formula C17H12FN3O2 and a molecular weight of 309.30 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(6-fluoronaphthalen-2-yl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(6-fluoronaphthalen-2-yl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547295 |
| Molecular Formula | C17H12FN3O2 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(6-fluoronaphthalen-2-yl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc2cc(F)ccc2c1 |
| InChI | InChI=1S/C17H12FN3O2/c1-23-17(22)16-15(20)12(8-19)9-21(16)14-5-3-10-6-13(18)4-2-11(10)7-14/h2-7,9H,20H2,1H3 |
| InChIKey | UZRHLNSXPCILAD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |