C15H15FN4O2 — CID 168549618
methyl 3-amino-4-cyano-1-[2-(ethylamino)-5-fluorophenyl]pyrrole-2-carboxylate (PubChem CID 168549618) has the molecular formula C15H15FN4O2 and a molecular weight of 302.31 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[2-(ethylamino)-5-fluorophenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[2-(ethylamino)-5-fluorophenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549618 |
| Molecular Formula | C15H15FN4O2 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[2-(ethylamino)-5-fluorophenyl]pyrrole-2-carboxylate |
| SMILES | CCNc1ccc(F)cc1-n1cc(C#N)c(N)c1C(=O)OC |
| InChI | InChI=1S/C15H15FN4O2/c1-3-19-11-5-4-10(16)6-12(11)20-8-9(7-17)13(18)14(20)15(21)22-2/h4-6,8,19H,3,18H2,1-2H3 |
| InChIKey | CIJNZEBOFXNHFC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |