C17H14FN5O2 — CID 168548239
methyl 3-amino-4-cyano-1-[5-fluoro-2-(2-methylimidazol-1-yl)phenyl]pyrrole-2-carboxylate (PubChem CID 168548239) has the molecular formula C17H14FN5O2 and a molecular weight of 339.33 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[5-fluoro-2-(2-methylimidazol-1-yl)phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[5-fluoro-2-(2-methylimidazol-1-yl)phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548239 |
| Molecular Formula | C17H14FN5O2 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[5-fluoro-2-(2-methylimidazol-1-yl)phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(F)ccc1-n1ccnc1C |
| InChI | InChI=1S/C17H14FN5O2/c1-10-21-5-6-22(10)13-4-3-12(18)7-14(13)23-9-11(8-19)15(20)16(23)17(24)25-2/h3-7,9H,20H2,1-2H3 |
| InChIKey | IYKSZQKKWSZGTB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |