C14H11FN4O3 — CID 168547122
methyl 3-amino-1-(3-carbamoyl-5-fluorophenyl)-4-cyanopyrrole-2-carboxylate (PubChem CID 168547122) has the molecular formula C14H11FN4O3 and a molecular weight of 302.27 g/mol. Its IUPAC name is methyl 3-amino-1-(3-carbamoyl-5-fluorophenyl)-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-(3-carbamoyl-5-fluorophenyl)-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547122 |
| Molecular Formula | C14H11FN4O3 |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | methyl 3-amino-1-(3-carbamoyl-5-fluorophenyl)-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(F)cc(C(N)=O)c1 |
| InChI | InChI=1S/C14H11FN4O3/c1-22-14(21)12-11(17)8(5-16)6-19(12)10-3-7(13(18)20)2-9(15)4-10/h2-4,6H,17H2,1H3,(H2,18,20) |
| InChIKey | RKVGAARGGUBHMI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |