C14H10N4O3 — CID 168547204
methyl 3-amino-4-cyano-1-(3-cyano-5-hydroxyphenyl)pyrrole-2-carboxylate (PubChem CID 168547204) has the molecular formula C14H10N4O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(3-cyano-5-hydroxyphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(3-cyano-5-hydroxyphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547204 |
| Molecular Formula | C14H10N4O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(3-cyano-5-hydroxyphenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(O)cc(C#N)c1 |
| InChI | InChI=1S/C14H10N4O3/c1-21-14(20)13-12(17)9(6-16)7-18(13)10-2-8(5-15)3-11(19)4-10/h2-4,7,19H,17H2,1H3 |
| InChIKey | PVKCQZWDCBQQQT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |