C14H11N5O7 — CID 168550176
methyl 3-amino-4-cyano-1-(4-methoxy-3,5-dinitrophenyl)pyrrole-2-carboxylate (PubChem CID 168550176) has the molecular formula C14H11N5O7 and a molecular weight of 361.27 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(4-methoxy-3,5-dinitrophenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(4-methoxy-3,5-dinitrophenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168550176 |
| Molecular Formula | C14H11N5O7 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(4-methoxy-3,5-dinitrophenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc([N+](=O)[O-])c(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11N5O7/c1-25-13-9(18(21)22)3-8(4-10(13)19(23)24)17-6-7(5-15)11(16)12(17)14(20)26-2/h3-4,6H,16H2,1-2H3 |
| InChIKey | ANLODFPEJZCRPQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 176.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|