C14H9N5O8 — CID 168549762
4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-3,5-dinitrobenzoic acid (PubChem CID 168549762) has the molecular formula C14H9N5O8 and a molecular weight of 375.25 g/mol. Its IUPAC name is 4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-3,5-dinitrobenzoic acid.
| Compound Name | 4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 168549762 |
| Molecular Formula | C14H9N5O8 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-3,5-dinitrobenzoic acid |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1c([N+](=O)[O-])cc(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9N5O8/c1-27-14(22)12-10(16)7(4-15)5-17(12)11-8(18(23)24)2-6(13(20)21)3-9(11)19(25)26/h2-3,5H,16H2,1H3,(H,20,21) |
| InChIKey | CIOGUQIYZMOQRG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 204.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|