C13H9ClN4O4 — CID 168545761
methyl 3-amino-1-(3-chloro-4-nitrophenyl)-4-cyanopyrrole-2-carboxylate (PubChem CID 168545761) has the molecular formula C13H9ClN4O4 and a molecular weight of 320.69 g/mol. Its IUPAC name is methyl 3-amino-1-(3-chloro-4-nitrophenyl)-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-(3-chloro-4-nitrophenyl)-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168545761 |
| Molecular Formula | C13H9ClN4O4 |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | methyl 3-amino-1-(3-chloro-4-nitrophenyl)-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C13H9ClN4O4/c1-22-13(19)12-11(16)7(5-15)6-17(12)8-2-3-10(18(20)21)9(14)4-8/h2-4,6H,16H2,1H3 |
| InChIKey | MWQOWRQMXSYKMN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|