C21H13N3O4 — CID 168547411
methyl 3-amino-4-cyano-1-(9,10-dioxoanthracen-2-yl)pyrrole-2-carboxylate (PubChem CID 168547411) has the molecular formula C21H13N3O4 and a molecular weight of 371.35 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(9,10-dioxoanthracen-2-yl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(9,10-dioxoanthracen-2-yl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547411 |
| Molecular Formula | C21H13N3O4 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(9,10-dioxoanthracen-2-yl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H13N3O4/c1-28-21(27)18-17(23)11(9-22)10-24(18)12-6-7-15-16(8-12)20(26)14-5-3-2-4-13(14)19(15)25/h2-8,10H,23H2,1H3 |
| InChIKey | GDSRBACXBIWXSM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 115.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|