C18H21N3O2 — CID 168548050
methyl 3-amino-4-cyano-1-(4-pentan-3-ylphenyl)pyrrole-2-carboxylate (PubChem CID 168548050) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(4-pentan-3-ylphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(4-pentan-3-ylphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548050 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(4-pentan-3-ylphenyl)pyrrole-2-carboxylate |
| SMILES | CCC(CC)c1ccc(-n2cc(C#N)c(N)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-4-12(5-2)13-6-8-15(9-7-13)21-11-14(10-19)16(20)17(21)18(22)23-3/h6-9,11-12H,4-5,20H2,1-3H3 |
| InChIKey | XIOOBCJSQBMTKN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |