C18H17N3O5 — CID 168545858
4-[4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)phenyl]-3-methyl-4-oxobutanoic acid (PubChem CID 168545858) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)phenyl]-3-methyl-4-oxobutanoic acid.
| Compound Name | 4-[4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)phenyl]-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 168545858 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-[4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)phenyl]-3-methyl-4-oxobutanoic acid |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(C(=O)C(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C18H17N3O5/c1-10(7-14(22)23)17(24)11-3-5-13(6-4-11)21-9-12(8-19)15(20)16(21)18(25)26-2/h3-6,9-10H,7,20H2,1-2H3,(H,22,23) |
| InChIKey | XWKXXFSEDMJUGL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |