C21H18N4O3 — CID 168549271
methyl 3-amino-4-cyano-1-[4-[methyl(phenyl)carbamoyl]phenyl]pyrrole-2-carboxylate (PubChem CID 168549271) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[4-[methyl(phenyl)carbamoyl]phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[4-[methyl(phenyl)carbamoyl]phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549271 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[4-[methyl(phenyl)carbamoyl]phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(C(=O)N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N4O3/c1-24(16-6-4-3-5-7-16)20(26)14-8-10-17(11-9-14)25-13-15(12-22)18(23)19(25)21(27)28-2/h3-11,13H,23H2,1-2H3 |
| InChIKey | CKOFOVBIKOQLBI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |