C17H13N5O2 — CID 168546420
methyl 3-amino-4-cyano-1-(4-pyrimidin-2-ylphenyl)pyrrole-2-carboxylate (PubChem CID 168546420) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(4-pyrimidin-2-ylphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(4-pyrimidin-2-ylphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546420 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(4-pyrimidin-2-ylphenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(-c2ncccn2)cc1 |
| InChI | InChI=1S/C17H13N5O2/c1-24-17(23)15-14(19)12(9-18)10-22(15)13-5-3-11(4-6-13)16-20-7-2-8-21-16/h2-8,10H,19H2,1H3 |
| InChIKey | MTLWQMNAKZYAMH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |