C20H15FN4O3 — CID 168546015
methyl 3-amino-4-cyano-1-[4-[(4-fluorophenyl)carbamoyl]phenyl]pyrrole-2-carboxylate (PubChem CID 168546015) has the molecular formula C20H15FN4O3 and a molecular weight of 378.36 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[4-[(4-fluorophenyl)carbamoyl]phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[4-[(4-fluorophenyl)carbamoyl]phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546015 |
| Molecular Formula | C20H15FN4O3 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[4-[(4-fluorophenyl)carbamoyl]phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(C(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H15FN4O3/c1-28-20(27)18-17(23)13(10-22)11-25(18)16-8-2-12(3-9-16)19(26)24-15-6-4-14(21)5-7-15/h2-9,11H,23H2,1H3,(H,24,26) |
| InChIKey | BHQNPHKXCIRDPH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |