C18H14N4O3S — CID 168549385
methyl 3-amino-4-cyano-1-[4-(thiophene-2-carbonylamino)phenyl]pyrrole-2-carboxylate (PubChem CID 168549385) has the molecular formula C18H14N4O3S and a molecular weight of 366.40 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[4-(thiophene-2-carbonylamino)phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[4-(thiophene-2-carbonylamino)phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549385 |
| Molecular Formula | C18H14N4O3S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[4-(thiophene-2-carbonylamino)phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H14N4O3S/c1-25-18(24)16-15(20)11(9-19)10-22(16)13-6-4-12(5-7-13)21-17(23)14-3-2-8-26-14/h2-8,10H,20H2,1H3,(H,21,23) |
| InChIKey | OZWNHDJQXXNCJF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |