C26H20N4O4 — CID 168550437
methyl 3-amino-4-cyano-1-[3-[(4-phenoxyphenyl)carbamoyl]phenyl]pyrrole-2-carboxylate (PubChem CID 168550437) has the molecular formula C26H20N4O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[3-[(4-phenoxyphenyl)carbamoyl]phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[3-[(4-phenoxyphenyl)carbamoyl]phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168550437 |
| Molecular Formula | C26H20N4O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[3-[(4-phenoxyphenyl)carbamoyl]phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cccc(C(=O)Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H20N4O4/c1-33-26(32)24-23(28)18(15-27)16-30(24)20-7-5-6-17(14-20)25(31)29-19-10-12-22(13-11-19)34-21-8-3-2-4-9-21/h2-14,16H,28H2,1H3,(H,29,31) |
| InChIKey | ZQCUDWUXVGDXCM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |