C20H13ClF2N4O3 — CID 168547936
methyl 3-amino-1-[3-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-4-cyanopyrrole-2-carboxylate (PubChem CID 168547936) has the molecular formula C20H13ClF2N4O3 and a molecular weight of 430.80 g/mol. Its IUPAC name is methyl 3-amino-1-[3-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-[3-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547936 |
| Molecular Formula | C20H13ClF2N4O3 |
| Molecular Weight | 430.80 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | methyl 3-amino-1-[3-[(2-chloro-4,5-difluorobenzoyl)amino]phenyl]-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cccc(NC(=O)c2cc(F)c(F)cc2Cl)c1 |
| InChI | InChI=1S/C20H13ClF2N4O3/c1-30-20(29)18-17(25)10(8-24)9-27(18)12-4-2-3-11(5-12)26-19(28)13-6-15(22)16(23)7-14(13)21/h2-7,9H,25H2,1H3,(H,26,28) |
| InChIKey | FXUHDLNBFDTOCL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|