C18H20N4O3 — CID 168548620
methyl 3-amino-4-cyano-1-[3-(pentanoylamino)phenyl]pyrrole-2-carboxylate (PubChem CID 168548620) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[3-(pentanoylamino)phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[3-(pentanoylamino)phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548620 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[3-(pentanoylamino)phenyl]pyrrole-2-carboxylate |
| SMILES | CCCCC(=O)Nc1cccc(-n2cc(C#N)c(N)c2C(=O)OC)c1 |
| InChI | InChI=1S/C18H20N4O3/c1-3-4-8-15(23)21-13-6-5-7-14(9-13)22-11-12(10-19)16(20)17(22)18(24)25-2/h5-7,9,11H,3-4,8,20H2,1-2H3,(H,21,23) |
| InChIKey | OQCUKKAVONVHKP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |