C15H12ClFN4O3 — CID 168547115
methyl 1-(4-acetamido-3-chloro-5-fluorophenyl)-3-amino-4-cyanopyrrole-2-carboxylate (PubChem CID 168547115) has the molecular formula C15H12ClFN4O3 and a molecular weight of 350.74 g/mol. Its IUPAC name is methyl 1-(4-acetamido-3-chloro-5-fluorophenyl)-3-amino-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 1-(4-acetamido-3-chloro-5-fluorophenyl)-3-amino-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547115 |
| Molecular Formula | C15H12ClFN4O3 |
| Molecular Weight | 350.74 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | methyl 1-(4-acetamido-3-chloro-5-fluorophenyl)-3-amino-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(F)c(NC(C)=O)c(Cl)c1 |
| InChI | InChI=1S/C15H12ClFN4O3/c1-7(22)20-13-10(16)3-9(4-11(13)17)21-6-8(5-18)12(19)14(21)15(23)24-2/h3-4,6H,19H2,1-2H3,(H,20,22) |
| InChIKey | JLIYIZLZZOQTNK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.74 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |