C13H9ClFN3O2 — CID 168545638
methyl 3-amino-1-(2-chloro-6-fluorophenyl)-4-cyanopyrrole-2-carboxylate (PubChem CID 168545638) has the molecular formula C13H9ClFN3O2 and a molecular weight of 293.69 g/mol. Its IUPAC name is methyl 3-amino-1-(2-chloro-6-fluorophenyl)-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-(2-chloro-6-fluorophenyl)-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168545638 |
| Molecular Formula | C13H9ClFN3O2 |
| Molecular Weight | 293.69 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | methyl 3-amino-1-(2-chloro-6-fluorophenyl)-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1c(F)cccc1Cl |
| InChI | InChI=1S/C13H9ClFN3O2/c1-20-13(19)12-10(17)7(5-16)6-18(12)11-8(14)3-2-4-9(11)15/h2-4,6H,17H2,1H3 |
| InChIKey | NESNSDVTDKQDHP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |