C19H22ClN5O2 — CID 168546532
methyl 3-amino-1-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-4-cyanopyrrole-2-carboxylate (PubChem CID 168546532) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is methyl 3-amino-1-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546532 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | methyl 3-amino-1-[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-4-cyanopyrrole-2-carboxylate |
| SMILES | CCN1CCN(c2c(Cl)cccc2-n2cc(C#N)c(N)c2C(=O)OC)CC1 |
| InChI | InChI=1S/C19H22ClN5O2/c1-3-23-7-9-24(10-8-23)17-14(20)5-4-6-15(17)25-12-13(11-21)16(22)18(25)19(26)27-2/h4-6,12H,3,7-10,22H2,1-2H3 |
| InChIKey | GBLGQNJCYAOUAK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 87.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |