C17H17FN4O3 — CID 168548436
methyl 3-amino-4-cyano-1-(2-fluoro-6-morpholin-4-ylphenyl)pyrrole-2-carboxylate (PubChem CID 168548436) has the molecular formula C17H17FN4O3 and a molecular weight of 344.35 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(2-fluoro-6-morpholin-4-ylphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(2-fluoro-6-morpholin-4-ylphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548436 |
| Molecular Formula | C17H17FN4O3 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(2-fluoro-6-morpholin-4-ylphenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1c(F)cccc1N1CCOCC1 |
| InChI | InChI=1S/C17H17FN4O3/c1-24-17(23)16-14(20)11(9-19)10-22(16)15-12(18)3-2-4-13(15)21-5-7-25-8-6-21/h2-4,10H,5-8,20H2,1H3 |
| InChIKey | PBUCKHRHTOGNHH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |