C17H19FN4O3 — CID 168548123
methyl 3-amino-4-cyano-1-[3-fluoro-2-(3-methoxypropylamino)phenyl]pyrrole-2-carboxylate (PubChem CID 168548123) has the molecular formula C17H19FN4O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[3-fluoro-2-(3-methoxypropylamino)phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[3-fluoro-2-(3-methoxypropylamino)phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548123 |
| Molecular Formula | C17H19FN4O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[3-fluoro-2-(3-methoxypropylamino)phenyl]pyrrole-2-carboxylate |
| SMILES | COCCCNc1c(F)cccc1-n1cc(C#N)c(N)c1C(=O)OC |
| InChI | InChI=1S/C17H19FN4O3/c1-24-8-4-7-21-15-12(18)5-3-6-13(15)22-10-11(9-19)14(20)16(22)17(23)25-2/h3,5-6,10,21H,4,7-8,20H2,1-2H3 |
| InChIKey | KEPFOEGZLDWREG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|