C18H17ClN4O4 — CID 168546919
methyl 3-amino-1-[2-chloro-5-(morpholine-4-carbonyl)phenyl]-4-cyanopyrrole-2-carboxylate (PubChem CID 168546919) has the molecular formula C18H17ClN4O4 and a molecular weight of 388.81 g/mol. Its IUPAC name is methyl 3-amino-1-[2-chloro-5-(morpholine-4-carbonyl)phenyl]-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-[2-chloro-5-(morpholine-4-carbonyl)phenyl]-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546919 |
| Molecular Formula | C18H17ClN4O4 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | methyl 3-amino-1-[2-chloro-5-(morpholine-4-carbonyl)phenyl]-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(C(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C18H17ClN4O4/c1-26-18(25)16-15(21)12(9-20)10-23(16)14-8-11(2-3-13(14)19)17(24)22-4-6-27-7-5-22/h2-3,8,10H,4-7,21H2,1H3 |
| InChIKey | LOOOZDYXQCAOIA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |