C13H8Cl2IN3O2 — CID 168545725
methyl 3-amino-4-cyano-1-(2,4-dichloro-6-iodophenyl)pyrrole-2-carboxylate (PubChem CID 168545725) has the molecular formula C13H8Cl2IN3O2 and a molecular weight of 436.04 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(2,4-dichloro-6-iodophenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(2,4-dichloro-6-iodophenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168545725 |
| Molecular Formula | C13H8Cl2IN3O2 |
| Molecular Weight | 436.04 g/mol |
| Exact Mass | 434.90 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(2,4-dichloro-6-iodophenyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1c(Cl)cc(Cl)cc1I |
| InChI | InChI=1S/C13H8Cl2IN3O2/c1-21-13(20)12-10(18)6(4-17)5-19(12)11-8(15)2-7(14)3-9(11)16/h2-3,5H,18H2,1H3 |
| InChIKey | XJOJYKZQKJWLEH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.04 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|