C16H12ClN3O3 — CID 168547290
methyl 3-amino-1-(7-chloro-2-methyl-1-benzofuran-5-yl)-4-cyanopyrrole-2-carboxylate (PubChem CID 168547290) has the molecular formula C16H12ClN3O3 and a molecular weight of 329.74 g/mol. Its IUPAC name is methyl 3-amino-1-(7-chloro-2-methyl-1-benzofuran-5-yl)-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-(7-chloro-2-methyl-1-benzofuran-5-yl)-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547290 |
| Molecular Formula | C16H12ClN3O3 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | methyl 3-amino-1-(7-chloro-2-methyl-1-benzofuran-5-yl)-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(Cl)c2oc(C)cc2c1 |
| InChI | InChI=1S/C16H12ClN3O3/c1-8-3-9-4-11(5-12(17)15(9)23-8)20-7-10(6-18)13(19)14(20)16(21)22-2/h3-5,7H,19H2,1-2H3 |
| InChIKey | TYVJZGRSLBBNTB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |