C24H26N4O3 — CID 168550327
methyl 1-[4-(2-adamantylcarbamoyl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate (PubChem CID 168550327) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is methyl 1-[4-(2-adamantylcarbamoyl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 1-[4-(2-adamantylcarbamoyl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168550327 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | methyl 1-[4-(2-adamantylcarbamoyl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(C(=O)NC2C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-31-24(30)22-20(26)18(11-25)12-28(22)19-4-2-15(3-5-19)23(29)27-21-16-7-13-6-14(9-16)10-17(21)8-13/h2-5,12-14,16-17,21H,6-10,26H2,1H3,(H,27,29) |
| InChIKey | IXJDPBSRDSTULT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |