C24H27N3O3 — CID 168550223
methyl 1-[3-(1-adamantyl)-4-methoxyphenyl]-3-amino-4-cyanopyrrole-2-carboxylate (PubChem CID 168550223) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is methyl 1-[3-(1-adamantyl)-4-methoxyphenyl]-3-amino-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 1-[3-(1-adamantyl)-4-methoxyphenyl]-3-amino-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168550223 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | methyl 1-[3-(1-adamantyl)-4-methoxyphenyl]-3-amino-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(OC)c(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C24H27N3O3/c1-29-20-4-3-18(27-13-17(12-25)21(26)22(27)23(28)30-2)8-19(20)24-9-14-5-15(10-24)7-16(6-14)11-24/h3-4,8,13-16H,5-7,9-11,26H2,1-2H3 |
| InChIKey | HXUBXXJPMHGWLS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |