C22H29N3O3 — CID 168550404
methyl 3-amino-4-cyano-1-(4-nonoxyphenyl)pyrrole-2-carboxylate (PubChem CID 168550404) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-(4-nonoxyphenyl)pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-(4-nonoxyphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168550404 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | methyl 3-amino-4-cyano-1-(4-nonoxyphenyl)pyrrole-2-carboxylate |
| SMILES | CCCCCCCCCOc1ccc(-n2cc(C#N)c(N)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C22H29N3O3/c1-3-4-5-6-7-8-9-14-28-19-12-10-18(11-13-19)25-16-17(15-23)20(24)21(25)22(26)27-2/h10-13,16H,3-9,14,24H2,1-2H3 |
| InChIKey | LOEKAHVMAUNGKL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|