C14H13FN4O4S — CID 168549146
methyl 3-amino-4-cyano-1-[4-fluoro-3-(methylsulfamoyl)phenyl]pyrrole-2-carboxylate (PubChem CID 168549146) has the molecular formula C14H13FN4O4S and a molecular weight of 352.35 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[4-fluoro-3-(methylsulfamoyl)phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[4-fluoro-3-(methylsulfamoyl)phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549146 |
| Molecular Formula | C14H13FN4O4S |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[4-fluoro-3-(methylsulfamoyl)phenyl]pyrrole-2-carboxylate |
| SMILES | CNS(=O)(=O)c1cc(-n2cc(C#N)c(N)c2C(=O)OC)ccc1F |
| InChI | InChI=1S/C14H13FN4O4S/c1-18-24(21,22)11-5-9(3-4-10(11)15)19-7-8(6-16)12(17)13(19)14(20)23-2/h3-5,7,18H,17H2,1-2H3 |
| InChIKey | QZHOKRHYSZVATR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |