C16H12ClN5O2 — CID 168547714
methyl 3-amino-1-(3-chloro-4-pyrazol-1-ylphenyl)-4-cyanopyrrole-2-carboxylate (PubChem CID 168547714) has the molecular formula C16H12ClN5O2 and a molecular weight of 341.76 g/mol. Its IUPAC name is methyl 3-amino-1-(3-chloro-4-pyrazol-1-ylphenyl)-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-(3-chloro-4-pyrazol-1-ylphenyl)-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168547714 |
| Molecular Formula | C16H12ClN5O2 |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | methyl 3-amino-1-(3-chloro-4-pyrazol-1-ylphenyl)-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(-n2cccn2)c(Cl)c1 |
| InChI | InChI=1S/C16H12ClN5O2/c1-24-16(23)15-14(19)10(8-18)9-21(15)11-3-4-13(12(17)7-11)22-6-2-5-20-22/h2-7,9H,19H2,1H3 |
| InChIKey | KXRRTYADBVNPMJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |