C13H11BN4O6 — CID 168548363
[3-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-5-nitrophenyl]boronic acid (PubChem CID 168548363) has the molecular formula C13H11BN4O6 and a molecular weight of 330.07 g/mol. Its IUPAC name is [3-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-5-nitrophenyl]boronic acid.
| Compound Name | [3-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-5-nitrophenyl]boronic acid |
|---|---|
| PubChem CID | 168548363 |
| Molecular Formula | C13H11BN4O6 |
| Molecular Weight | 330.07 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [3-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)-5-nitrophenyl]boronic acid |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(B(O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11BN4O6/c1-24-13(19)12-11(16)7(5-15)6-17(12)9-2-8(14(20)21)3-10(4-9)18(22)23/h2-4,6,20-21H,16H2,1H3 |
| InChIKey | JRYROYQWVREUHE-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 164.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.07 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|