C19H13FN4O5 — CID 168548971
methyl 3-amino-4-cyano-1-[3-(4-fluorophenoxy)-5-nitrophenyl]pyrrole-2-carboxylate (PubChem CID 168548971) has the molecular formula C19H13FN4O5 and a molecular weight of 396.33 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[3-(4-fluorophenoxy)-5-nitrophenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[3-(4-fluorophenoxy)-5-nitrophenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548971 |
| Molecular Formula | C19H13FN4O5 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[3-(4-fluorophenoxy)-5-nitrophenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(Oc2ccc(F)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H13FN4O5/c1-28-19(25)18-17(22)11(9-21)10-23(18)13-6-14(24(26)27)8-16(7-13)29-15-4-2-12(20)3-5-15/h2-8,10H,22H2,1H3 |
| InChIKey | VBGRZBYDHQKQNK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|