C15H8Cl2F3N7 — CID 54182175
2-amino-3-[2-[2-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazol-4-yl]ethylideneamino]but-2-enedinitrile (PubChem CID 54182175) has the molecular formula C15H8Cl2F3N7 and a molecular weight of 414.18 g/mol. Its IUPAC name is 2-amino-3-[2-[2-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazol-4-yl]ethylideneamino]but-2-enedinitrile.
| Compound Name | 2-amino-3-[2-[2-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazol-4-yl]ethylideneamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 54182175 |
| Molecular Formula | C15H8Cl2F3N7 |
| Molecular Weight | 414.18 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 2-amino-3-[2-[2-[2,6-dichloro-4-(trifluoromethyl)phenyl]triazol-4-yl]ethylideneamino]but-2-enedinitrile |
| SMILES | N#CC(N)=C(C#N)/N=C/Cc1cnn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C15H8Cl2F3N7/c16-10-3-8(15(18,19)20)4-11(17)14(10)27-25-7-9(26-27)1-2-24-13(6-22)12(23)5-21/h2-4,7H,1,23H2/b13-12?,24-2+ |
| InChIKey | PCOMHUDNQBIMCT-FLPQDRKMSA-N |
| XLogP | 3.42 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.18 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|