C9H4Cl3F5N2 — CID 15906753
2-chloro-N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,2-difluoroethanimidamide (PubChem CID 15906753) has the molecular formula C9H4Cl3F5N2 and a molecular weight of 341.49 g/mol. Its IUPAC name is 2-chloro-N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,2-difluoroethanimidamide.
| Compound Name | 2-chloro-N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,2-difluoroethanimidamide |
|---|---|
| PubChem CID | 15906753 |
| Molecular Formula | C9H4Cl3F5N2 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 339.94 |
| IUPAC Name | 2-chloro-N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2,2-difluoroethanimidamide |
| SMILES | N/C(=N/c1c(Cl)cc(C(F)(F)F)cc1Cl)C(F)(F)Cl |
| InChI | InChI=1S/C9H4Cl3F5N2/c10-4-1-3(9(15,16)17)2-5(11)6(4)19-7(18)8(12,13)14/h1-2H,(H2,18,19) |
| InChIKey | XYHDJHMMVRSYEA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|