C8H7Cl2F3N3O2S+ — CID 6977612
diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium (PubChem CID 6977612) has the molecular formula C8H7Cl2F3N3O2S+ and a molecular weight of 337.13 g/mol. Its IUPAC name is diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium.
| Compound Name | diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium |
|---|---|
| PubChem CID | 6977612 |
| Molecular Formula | C8H7Cl2F3N3O2S+ |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium |
| SMILES | NC(N)=[NH+]S(=O)(=O)c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H6Cl2F3N3O2S/c9-4-1-3(8(11,12)13)2-5(10)6(4)19(17,18)16-7(14)15/h1-2H,(H4,14,15,16)/p+1 |
| InChIKey | CKOIZBSZOOSWPI-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|