About diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium
diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium (PubChem CID 6977612) has the molecular formula C8H7Cl2F3N3O2S+
and a molecular weight of 337.13 g/mol. Its IUPAC name is diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium.
Molecular Properties
| Compound Name | diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium |
| PubChem CID | 6977612 |
| Molecular Formula | C8H7Cl2F3N3O2S+ |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium |
| SMILES | NC(N)=[NH+]S(=O)(=O)c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H6Cl2F3N3O2S/c9-4-1-3(8(11,12)13)2-5(10)6(4)19(17,18)16-7(14)15/h1-2H,(H4,14,15,16)/p+1 |
| InChIKey | CKOIZBSZOOSWPI-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium?
The IUPAC name of diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium (CID 6977612) is diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium.
What is the SMILES notation for diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium?
The canonical SMILES for diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium is NC(N)=[NH+]S(=O)(=O)c1c(Cl)cc(C(F)(F)F)cc1Cl.
What is the InChIKey of diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium?
The InChIKey is CKOIZBSZOOSWPI-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H6Cl2F3N3O2S/c9-4-1-3(8(11,12)13)2-5(10)6(4)19(17,18)16-7(14)15/h1-2H,(H4,14,15,16)/p+1.
What are the key properties of diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium?
diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium has a molecular weight of 337.13 g/mol, XLogP of 0.05, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diaminomethylidene-[2,6-dichloro-4-(trifluoromethyl)phenyl]sulfonylazanium is sourced from PubChem (CID 6977612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).