C13H2Cl2F8O3S — CID 43835685
(2,3,4,5,6-pentafluorophenyl) 2,6-dichloro-4-(trifluoromethyl)benzenesulfonate (PubChem CID 43835685) has the molecular formula C13H2Cl2F8O3S and a molecular weight of 461.11 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2,6-dichloro-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2,6-dichloro-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 43835685 |
| Molecular Formula | C13H2Cl2F8O3S |
| Molecular Weight | 461.11 g/mol |
| Exact Mass | 459.90 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2,6-dichloro-4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(F)c(F)c1F)c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H2Cl2F8O3S/c14-4-1-3(13(21,22)23)2-5(15)12(4)27(24,25)26-11-9(19)7(17)6(16)8(18)10(11)20/h1-2H |
| InChIKey | OYQUKRVHXFTHGI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.11 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|