C8H7Cl2F3N2 — CID 58121577
N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]methanediamine (PubChem CID 58121577) has the molecular formula C8H7Cl2F3N2 and a molecular weight of 259.06 g/mol. Its IUPAC name is N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]methanediamine.
| Compound Name | N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]methanediamine |
|---|---|
| PubChem CID | 58121577 |
| Molecular Formula | C8H7Cl2F3N2 |
| Molecular Weight | 259.06 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | N'-[2,6-dichloro-4-(trifluoromethyl)phenyl]methanediamine |
| SMILES | NCNc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H7Cl2F3N2/c9-5-1-4(8(11,12)13)2-6(10)7(5)15-3-14/h1-2,15H,3,14H2 |
| InChIKey | BJQGOAMHZYIQQY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.06 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|