C14H18ClF3N2 — CID 116698793
N-[2-(aminomethyl)cyclohexyl]-3-chloro-5-(trifluoromethyl)aniline (PubChem CID 116698793) has the molecular formula C14H18ClF3N2 and a molecular weight of 306.76 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-3-chloro-5-(trifluoromethyl)aniline.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-3-chloro-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 116698793 |
| Molecular Formula | C14H18ClF3N2 |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-3-chloro-5-(trifluoromethyl)aniline |
| SMILES | NCC1CCCCC1Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18ClF3N2/c15-11-5-10(14(16,17)18)6-12(7-11)20-13-4-2-1-3-9(13)8-19/h5-7,9,13,20H,1-4,8,19H2 |
| InChIKey | HWIOLGILHPXYGQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |