C12H15ClF3N — CID 116699062
3-chloro-N-(2,2-dimethylpropyl)-5-(trifluoromethyl)aniline (PubChem CID 116699062) has the molecular formula C12H15ClF3N and a molecular weight of 265.71 g/mol. Its IUPAC name is 3-chloro-N-(2,2-dimethylpropyl)-5-(trifluoromethyl)aniline.
| Compound Name | 3-chloro-N-(2,2-dimethylpropyl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 116699062 |
| Molecular Formula | C12H15ClF3N |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 3-chloro-N-(2,2-dimethylpropyl)-5-(trifluoromethyl)aniline |
| SMILES | CC(C)(C)CNc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15ClF3N/c1-11(2,3)7-17-10-5-8(12(14,15)16)4-9(13)6-10/h4-6,17H,7H2,1-3H3 |
| InChIKey | UTIXRAFFMNPBBA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |