About 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline
3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline (PubChem CID 104921789) has the molecular formula C11H7Cl2F3N2S
and a molecular weight of 327.16 g/mol. Its IUPAC name is 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline |
| PubChem CID | 104921789 |
| Molecular Formula | C11H7Cl2F3N2S |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(Cl)cc(NCc2ncc(Cl)s2)c1 |
| InChI | InChI=1S/C11H7Cl2F3N2S/c12-7-1-6(11(14,15)16)2-8(3-7)17-5-10-18-4-9(13)19-10/h1-4,17H,5H2 |
| InChIKey | XWNWDWNWFBNPMV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline?
The IUPAC name of 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline (CID 104921789) is 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline.
What is the SMILES notation for 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline?
The canonical SMILES for 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline is FC(F)(F)c1cc(Cl)cc(NCc2ncc(Cl)s2)c1.
What is the InChIKey of 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline?
The InChIKey is XWNWDWNWFBNPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl2F3N2S/c12-7-1-6(11(14,15)16)2-8(3-7)17-5-10-18-4-9(13)19-10/h1-4,17H,5H2.
What are the key properties of 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline?
3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline has a molecular weight of 327.16 g/mol, XLogP of 5.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-5-(trifluoromethyl)aniline is sourced from PubChem (CID 104921789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).