C11H7ClF3IN2S — CID 168580762
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-iodo-5-(trifluoromethyl)aniline (PubChem CID 168580762) has the molecular formula C11H7ClF3IN2S and a molecular weight of 418.61 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-iodo-5-(trifluoromethyl)aniline.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-iodo-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 168580762 |
| Molecular Formula | C11H7ClF3IN2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 417.90 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-iodo-5-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(I)cc(NCc2cnc(Cl)s2)c1 |
| InChI | InChI=1S/C11H7ClF3IN2S/c12-10-18-5-9(19-10)4-17-8-2-6(11(13,14)15)1-7(16)3-8/h1-3,5,17H,4H2 |
| InChIKey | CRKBUODHVWSPGB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|