C10H7Br2ClN2S — CID 168584230
3,5-dibromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]aniline (PubChem CID 168584230) has the molecular formula C10H7Br2ClN2S and a molecular weight of 382.51 g/mol. Its IUPAC name is 3,5-dibromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]aniline.
| Compound Name | 3,5-dibromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 168584230 |
| Molecular Formula | C10H7Br2ClN2S |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 379.84 |
| IUPAC Name | 3,5-dibromo-N-[(2-chloro-1,3-thiazol-5-yl)methyl]aniline |
| SMILES | Clc1ncc(CNc2cc(Br)cc(Br)c2)s1 |
| InChI | InChI=1S/C10H7Br2ClN2S/c11-6-1-7(12)3-8(2-6)14-4-9-5-15-10(13)16-9/h1-3,5,14H,4H2 |
| InChIKey | STMVBBJJTNXVJB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |