C10H6BrCl2FN2S — CID 168580141
4-bromo-3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoroaniline (PubChem CID 168580141) has the molecular formula C10H6BrCl2FN2S and a molecular weight of 356.05 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoroaniline.
| Compound Name | 4-bromo-3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoroaniline |
|---|---|
| PubChem CID | 168580141 |
| Molecular Formula | C10H6BrCl2FN2S |
| Molecular Weight | 356.05 g/mol |
| Exact Mass | 353.88 |
| IUPAC Name | 4-bromo-3-chloro-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoroaniline |
| SMILES | Fc1cc(NCc2cnc(Cl)s2)cc(Cl)c1Br |
| InChI | InChI=1S/C10H6BrCl2FN2S/c11-9-7(12)1-5(2-8(9)14)15-3-6-4-16-10(13)17-6/h1-2,4,15H,3H2 |
| InChIKey | MFDZKHHDYLLYTM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.05 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|