C10H7Cl3N2OS — CID 168580497
2,6-dichloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenol (PubChem CID 168580497) has the molecular formula C10H7Cl3N2OS and a molecular weight of 309.61 g/mol. Its IUPAC name is 2,6-dichloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenol.
| Compound Name | 2,6-dichloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenol |
|---|---|
| PubChem CID | 168580497 |
| Molecular Formula | C10H7Cl3N2OS |
| Molecular Weight | 309.61 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | 2,6-dichloro-4-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenol |
| SMILES | Oc1c(Cl)cc(NCc2cnc(Cl)s2)cc1Cl |
| InChI | InChI=1S/C10H7Cl3N2OS/c11-7-1-5(2-8(12)9(7)16)14-3-6-4-15-10(13)17-6/h1-2,4,14,16H,3H2 |
| InChIKey | WWHHEYKLLWGZCF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|